Quorumpeps Molecule

Quorumpeps®

DMCNGYF, thiolacton linkage between C3 and F7

Quorumpeps moleculeID32
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)CC(=O)N)CCSC
Molecular formulaC36H46N8O11S2
Chemical information
Species origin
Literature