Quorumpeps Molecule

Quorumpeps®

ANCDFLL, thiolacton linkage between C3 and L7

Quorumpeps moleculeID320
SMILESO=C(N)CC(NC(=O)C(N)C)C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)CC(C)C)CC(C)C)Cc2ccccc2)CC(=O)O
Molecular formulaC35H52N8O10S
Chemical information
Species origin
Functionality
Literature