Quorumpeps Molecule

Quorumpeps®

INDapAFLL, amide linkage between Dap3 and L7

Quorumpeps moleculeID322
SMILESO=C(N)CC(NC(=O)C(N)C(C)CC)C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1)CC(C)C)CC(C)C)Cc2ccccc2)C
Molecular formulaC37H59N9O8
Chemical information
Species origin
Functionality
Literature