Quorumpeps Molecule

Quorumpeps®

Ac-DapAFLL, amide linkage between Dap1 and L5

Quorumpeps moleculeID323
SMILESO=C1NC(C(=O)NCC(C(=O)NC(C(=O)NC(C(=O)NC1CC(C)C)Cc2ccccc2)C)NC(=O)C)CC(C)C
Molecular formulaC29H44N6O6
Chemical information
Species origin
Functionality
Literature