Quorumpeps Molecule

Quorumpeps®

Ac-CNAYF, thiolacton linkage between C1 and F5

Quorumpeps moleculeID324
SMILESO=C1SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1Cc2ccccc2)Cc3ccc(O)cc3)C)CC(=O)N)NC(=O)C
Molecular formulaC30H36N6O8S
Chemical information
Species origin
Functionality
Literature