Quorumpeps Molecule

Quorumpeps®

Ac-CNGYF, thiolacton linkage between C1 and F5

Quorumpeps moleculeID325
SMILESO=C1SCC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC1Cc2ccccc2)Cc3ccc(O)cc3)CC(=O)N)NC(=O)C
Molecular formulaC29H34N6O8S
Chemical information
Species origin
Functionality
Literature