Quorumpeps Molecule

Quorumpeps®

Ac-CASYF, thiolacton linkage between C1 and F5

Quorumpeps moleculeID326
SMILESO=C1SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1Cc2ccccc2)Cc3ccc(O)cc3)CO)C)NC(=O)C
Molecular formulaC29H35N5O8S
Chemical information
Species origin
Functionality
Literature