Quorumpeps Molecule

Quorumpeps®

Ac-CN(trityl)GY(tBu)F, thiolacton linkage between C1 and F5

Quorumpeps moleculeID328
SMILESO=C1SCC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC1Cc2ccccc2)Cc3ccc(OC(C)(C)C)cc3)CC(=O)NC(c4ccccc4)(c5ccccc5)c6ccccc6)NC(=O)C
Molecular formulaC52H56N6O8S
Chemical information
Species origin
Functionality
Literature