Quorumpeps Molecule

Quorumpeps®

DSVCAAYF, thiolacton linkage between C4 and F8

Quorumpeps moleculeID334
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)C)C)C(C)C)CO
Molecular formulaC39H52N8O12S
Chemical information
Species origin
Functionality
Literature