Quorumpeps Molecule

Quorumpeps®

DSVCYSYF, thiolacton linkage between C4 and F8

Quorumpeps moleculeID339
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)CO)Cc4ccc(O)cc4)C(C)C)CO
Molecular formulaC45H56N8O14S
Chemical information
Species origin
Functionality
Literature