Quorumpeps Molecule

Quorumpeps®

DRVGA

Quorumpeps moleculeID34
SMILESO=C(NC(C(=O)O)C)CNC(=O)C(NC(=O)C(NC(=O)C(N)CC(=O)O)CCCNC(=[N@H])N)C(C)C
Molecular formulaC20H36N8O8
Chemical information
Species origin
Functionality
Literature