Quorumpeps Molecule

Quorumpeps®

ASVCAAYF , thiolacton linkage between C4 and F8

Quorumpeps moleculeID343
SMILESO=C(NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)C)C)C(C)C)CO)C(N)C
Molecular formulaC38H52N8O10S
Chemical information
Species origin
Functionality
Literature