Quorumpeps Molecule

Quorumpeps®

ASKYNPCSNYL, thiolacton linkage between C7 and L11

Quorumpeps moleculeID346
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC2)CC(C)C)Cc3ccc(O)cc3)CC(=O)N)CO)CC(=O)N)Cc4ccc(O)cc4)CCCCN)CO)C(N)C
Molecular formulaC55H80N14O17S
Chemical information
Species origin
Functionality
Literature