Quorumpeps Molecule

Quorumpeps®

SKYNPCSNYL, thiolacton linkage between C6 and L10

Quorumpeps moleculeID347
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)N1CCCC1C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC2)CC(C)C)Cc3ccc(O)cc3)CC(=O)N)CO)CC(=O)N)Cc4ccc(O)cc4)CCCCN)C(N)CO
Molecular formulaC52H75N13O16S
Chemical information
Species origin
Functionality
Literature