Quorumpeps Molecule

Quorumpeps®

NPCSNYL, thiolacton linkage between C3 and L7

Quorumpeps moleculeID348
SMILESO=C(N)CC(N)C(=O)N1CCCC1C(=O)NC2C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC2)CC(C)C)Cc3ccc(O)cc3)CC(=O)N)CO
Molecular formulaC34H49N9O11S
Chemical information
Species origin
Functionality
Literature