Quorumpeps Molecule

Quorumpeps®

Ac-CSNYL, thiolacton linkage between C1 and L5

Quorumpeps moleculeID349
SMILESO=C1SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1CC(C)C)Cc2ccc(O)cc2)CC(=O)N)CO)NC(=O)C
Molecular formulaC27H38N6O9S
Chemical information
Species origin
Functionality
Literature