Quorumpeps Molecule

Quorumpeps®

DSACHLGI, thiolacton linkage between C4 and I8

Quorumpeps moleculeID35
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)SC1)C(C)CC)CC(C)C)Cc2cncn2)C)CO
Molecular formulaC33H52N10O11S1
Chemical information
Species origin
Functionality
Literature