Quorumpeps Molecule

Quorumpeps®

DSACVFGA, thiolacton linkage between C4 and A8

Quorumpeps moleculeID36
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)SC1)C)Cc2ccccc2)C(C)C)C)CO
Molecular formulaC32H46N8O11S1
Chemical information
Species origin
Functionality
Literature