Quorumpeps Molecule

Quorumpeps®

DSACVYGF, thiolacton linkage between C4 and F8

Quorumpeps moleculeID37
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)SC1)Cc2ccccc2)Cc3ccc(O)cc3)C(C)C)C)CO
Molecular formulaC38H50N8O12S1
Chemical information
Species origin
Functionality
Literature