Quorumpeps Molecule

Quorumpeps®

DSACYVSA, thiolacton linkage between C4 and A8

Quorumpeps moleculeID38
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)SC1)C)CO)C(C)C)Cc2ccc(O)cc2)C)CO
Molecular formulaC33H48N8O13S1
Chemical information
Species origin
Functionality
Literature