Quorumpeps Molecule

Quorumpeps®

DSACVVGI, thiolacton linkage between C4 and I8

Quorumpeps moleculeID39
SMILESO=C(O)CC(N)C(=O)NC(C(=O)NC(C(=O)NC1C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)SC1)C(C)CC)C(C)C)C(C)C)C)CO
Molecular formulaC31H52N8O11S1
Chemical information
Species origin
Functionality
Literature