Quorumpeps Molecule

Quorumpeps®

Ac-CGGLF, thiolacton linkage between C1 and F5

Quorumpeps moleculeID4
SMILESO=C1SCC(C(=O)NCC(=O)NCC(=O)NC(C(=O)NC1Cc2ccccc2)CC(C)C)NC(=O)C
Molecular formulaC24H33N5O6S
Chemical information
Species origin
Functionality
Literature