Quorumpeps Molecule

Quorumpeps®

CVLVTL, thiolacton linkage between C1 and L6

Quorumpeps moleculeID42
SMILESO=C1SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1CC(C)C)C(O)C)C(C)C)CC(C)C)C(C)C)N
Molecular formulaC29H52N6O7S1
Chemical information
Species origin
Functionality
Literature