Quorumpeps Molecule

Quorumpeps®

EKMIG

Quorumpeps moleculeID44
SMILESO=C(NC(C(=O)NC(C(=O)NCC(=O)O)C(C)CC)CCSC)C(NC(=O)C(N)CCC(=O)O)CCCCN
Molecular formulaC24H44N6O8S
Chemical information
Species origin
Functionality
Literature