Quorumpeps Molecule

Quorumpeps®

ERPVG

Quorumpeps moleculeID52
SMILESO=C(NC(C(=O)NCC(=O)O)C(C)C)C1N(C(=O)C(NC(=O)C(N)CCC(=O)O)CCCNC(=[N@H])N)CCC1
Molecular formulaC23H40N8O8
Chemical information
Species origin
Functionality
Literature