Quorumpeps Molecule

Quorumpeps®

DPITRQW(Farnesyl)GD

Quorumpeps moleculeID57
SMILESO=C(O)CC(N)C(=O)N1CCCC1C(=O)NC(C(C)CC)C(=O)NC(C(C)O)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCC(N)=O)C(=O)N2C(CC3(C\C=C(/C)CC\C=C(/C)CC\C=C(/C)C)c4ccccc4NC23)C(=O)NCC(=O)NC(CC(=O)O)C(=O)O
Molecular formulaC62H94N14O16
Chemical information
Species origin
Literature