Quorumpeps Molecule

Quorumpeps®

DSRIRMGFDFSKLFGK

Quorumpeps moleculeID58
SMILESOC(=O)CC(N)C(=O)NC(CO)C(=O)NC(CCCNC(=N)N)C(=O)NC(C(C)CC)C(=O)NC(CCCNC(=N)N)C(=O)NC(CCSC)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NC(CC(=O)O)C(=O)NC(Cc2ccccc2)C(=O)NC(CO)C(=O)NC(CCCCN)C(=O)NC(CC(C)C)C(=O)NC(Cc3ccccc3)C(=O)NCC(=O)NC(CCCCN)C(=O)O
Molecular formulaC86H134N24O23S
Chemical information
Species origin
Functionality
Literature