Quorumpeps Molecule

Quorumpeps®

Ac-CSGLF, thiolacton linkage between C1 and F5

Quorumpeps moleculeID6
SMILESO=C1SCC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC1Cc2ccccc2)CC(C)C)CO)NC(=O)C
Molecular formulaC25H35N5O7S
Chemical information
Species origin
Functionality
Literature