Quorumpeps Molecule

Quorumpeps®

LDW(Geranyl)KY

Quorumpeps moleculeID65
SMILESO=C(O)C(Cc1ccc(O)cc1)NC(=O)C(CCCCN)NC(=O)C2CC3(C\C=C(/C)CC\C=C(/C)C)c4ccccc4NC3N2C(=O)C(CC(=O)O)NC(=O)C(N)CC(C)C
Molecular formulaC46H65N7O9
Chemical information
Species origin
Literature