Quorumpeps Molecule

Quorumpeps®

KCVLVTL, thiolacton linkage between C2 and L7

Quorumpeps moleculeID66
SMILESO=C1SCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC1CC(C)C)C(O)C)C(C)C)CC(C)C)C(C)C)NC(=O)C(N)CCCCN
Molecular formulaC35H64N8O8S1
Chemical information
Species origin
Functionality
Literature