Quorumpeps Molecule

Quorumpeps®

MDW(Geranyl)HY

Quorumpeps moleculeID67
SMILESO=C(O)C(Cc1ccc(O)cc1)NC(=O)C(Cc2cncn2)NC(=O)C3CC4(C\C=C(/C)CC\C=C(/C)C)c5ccccc5NC4N3C(=O)C(CC(=O)O)NC(=O)C(N)CCSC
Molecular formulaC45H58N8O9S
Chemical information
Species origin
Literature