Quorumpeps Molecule

Quorumpeps®

Ac-CSSLF, thiolacton linkage between C1 and F5

Quorumpeps moleculeID68
SMILESCC(C)CC2NC(=O)C(NC(=O)C(NC(=O)C(CSC(=O)C(Cc1ccccc1)NC2=O)NC(C)=O)CO)CO
Molecular formulaC26H37N5O8S
Chemical information
Species origin
Functionality
Literature