Quorumpeps Molecule

Quorumpeps®

YSPWTNF-NH2

Quorumpeps moleculeID7
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N)Cc1ccccc1)CC(=O)N)C(O)C)Cc3c2ccccc2nc3)C5N(C(=O)C(NC(=O)C(N)Cc4ccc(O)cc4)CO)CCC5
Molecular formulaC45H56N10O11
Chemical information
Species origin
Functionality
Literature