Quorumpeps Molecule
Quorumpeps®
Download optimized .hin file.
The .hin structure file is rendered using the open source javascript library Jmol. You might need to enable javascript and/or allow the javascript to be executed. If the applet does not work, you can download the .hin file and open it locally using your preferred client.
The geometry optimization was obtained by the molecular mechanics force field method, using the Polak–Ribière conjugate gradient algorithm with a rootmean-square (RMS) gradient of 0.1 kcal/ (Å×mol) as stop criterion using the Hyperchem Professional 8.0 software (Hypercube, Gainesville, FL, USA). The structure can be rotated by dragging the structure; zooming is possible by scrolling on it.
YSPWTNF-NH2
| Quorumpeps moleculeID | 7 |
| SMILES | O=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N)Cc1ccccc1)CC(=O)N)C(O)C)Cc3c2ccccc2nc3)C5N(C(=O)C(NC(=O)C(N)Cc4ccc(O)cc4)CO)CCC5 |
| Molecular formula | C45H56N10O11 |
Chemical information
| Quorumpeps moleculeID | 7 |
| Sequence | YSPWTNF-NH2 |
| Trivial names | RIP, RNAIII Inhibiting Peptide |
| SMILES | O=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N)Cc1ccccc1)CC(=O)N)C(O)C)Cc3c2ccccc2nc3)C5N(C(=O)C(NC(=O)C(N)Cc4ccc(O)cc4)CO)CCC5 |
| Molecular formula | C45H56N10O11 |
| Molecular weight | 913.11 |
| LogP | -2.5 |
| Isoelectric point (pl) | 8.6 |
Species origin
Functionality
Links
Literature
