Quorumpeps Molecule

Quorumpeps®

QNCPNIFGQWM, thiolacton linkage between C3 and M11

Quorumpeps moleculeID71
SMILESNC(=O)CCC(N)C(=O)NC(CC(N)=O)C(=O)NC5CSC(=O)C(CCSC)NC(=O)C(Cc2cnc1ccccc12)NC(=O)C(CCC(N)=O)NC(=O)CNC(=O)C(Cc3ccccc3)NC(=O)C(NC(=O)C(CC(N)=O)NC(=O)C4CCCN4C5=O)C(C)CC
Molecular formulaC59H82N16O15S2
Chemical information
Species origin
Functionality
Literature