Quorumpeps Molecule

Quorumpeps®

QNHsePNIFGQWM, lacton linkage between HSr3 and M11

Quorumpeps moleculeID72
SMILESNC(=O)CCC(N)C(=O)NC(CC(N)=O)C(=O)NC4CCOC(=O)C(CCSC)NC(=O)C(Cc2cnc1ccccc12)NC(=O)C(CCC(N)=O)NC(=O)CNC(=O)C(Cc3ccccc3)NC(=O)C(NC(=O)C5CCCN5C4=O)C(C)CC
Molecular formulaC56H78N14O14S
Chemical information
Species origin
Functionality
Literature