Quorumpeps Molecule

Quorumpeps®

TNGNW(Geranyl)VPS

Quorumpeps moleculeID79
SMILESO=C(O)C(CO)NC(=O)C1CCCN1C(=O)C(NC(=O)C2CC3(C\C=C(/C)CC\C=C(/C)C)c4ccccc4NC3N2C(=O)C(CC(N)=O)NC(=O)CNC(=O)C(CC(N)=O)NC(=O)C(N)C(C)O)C(C)C
Molecular formulaC48H71N11O13
Chemical information
Species origin
Literature