Quorumpeps Molecule

Quorumpeps®

Ac-NSPNIFGQWM, lacton linkage between S2 and M10

Quorumpeps moleculeID8
SMILESO=C(NC(=O)CC(N)C(=O)NC1C(=O)N5C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC(C(=O)OC1)CCSC)Cc3c2ccccc2nc3)CCC(=O)N)Cc4ccccc4)C(C)CC)CC(=O)N)CCC5)C
Molecular formulaC56H76N14O15S
Chemical information
Species origin
Functionality
Literature