Quorumpeps Molecule

Quorumpeps®

YKPITNF-NH2

Quorumpeps moleculeID81
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N)Cc1ccccc1)CC(=O)N)C(O)C)C(C)CC)C3N(C(=O)C(NC(=O)C(N)Cc2ccc(O)cc2)CCCCN)CCC3
Molecular formulaC43H64N10O10
Chemical information
Species origin
Functionality
Literature