Quorumpeps Molecule

Quorumpeps®

YKPITN-NH2

Quorumpeps moleculeID82
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)N)CC(=O)N)C(O)C)C(C)CC)C2N(C(=O)C(NC(=O)C(N)Cc1ccc(O)cc1)CCCCN)CCC2
Molecular formulaC34H55N9O9
Chemical information
Species origin
Functionality
Literature