Quorumpeps Molecule

Quorumpeps®

YSPCTNFF, thiolacton linkage between C4 and F8

Quorumpeps moleculeID83
SMILESOc1ccc(cc1)CC(N)C(=O)NC(CO)C(=O)N2CCCC2C(=O)NC5CSC(=O)C(Cc3ccccc3)NC(=O)C(Cc4ccccc4)NC(=O)C(NC(=O)C(NC5=O)C(C)O)CC(N)=O
Molecular formulaC46H57N9O12S
Chemical information
Species origin
Literature