Quorumpeps Molecule

Quorumpeps®

YSPCTNFF

Quorumpeps moleculeID84
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O)Cc1ccccc1)Cc2ccccc2)CC(=O)N)C(O)C)CS)C4N(C(=O)C(NC(=O)C(N)Cc3ccc(O)cc3)CO)CCC4
Molecular formulaC46H59N9O13S1
Chemical information
Species origin
Functionality
Literature