Quorumpeps Molecule

Quorumpeps®

YSPCTNF

Quorumpeps moleculeID85
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O)Cc1ccccc1)CC(=O)N)C(O)C)CS)C3N(C(=O)C(NC(=O)C(N)Cc2ccc(O)cc2)CO)CCC3
Molecular formulaC37H50N8O12S1
Chemical information
Species origin
Functionality
Literature