Quorumpeps Molecule

Quorumpeps®

YTNGNW(Geranyl)VPS

Quorumpeps moleculeID86
SMILESO=C(O)C(CO)NC(=O)C1CCCN1C(=O)C(NC(=O)C2CC4(C\C=C(/C)CC\C=C(/C)C)c5ccccc5NC4N2C(=O)C(CC(N)=O)NC(=O)CNC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)Cc3ccc(O)cc3)C(C)O)C(C)C
Molecular formulaC57H80N12O15
Chemical information
Species origin
Functionality
Literature