Quorumpeps Molecule

Quorumpeps®

FW(Geranyl)E

Quorumpeps moleculeID87
SMILESO=C(O)C(CCC(=O)O)NC(=O)C1CC3(C\C=C(/C)CC\C=C(/C)C)c4ccccc4NC3N1C(=O)C(N)Cc2ccccc2
Molecular formulaC35H44N4O6
Chemical information
Species origin
Functionality
Literature