Quorumpeps Molecule

Quorumpeps®

FW(Geranyl)EQ

Quorumpeps moleculeID88
SMILESO=C(O)C(CCC(N)=O)NC(=O)C(CCC(=O)O)NC(=O)C1CC3(C\C=C(/C)CC\C=C(/C)C)c4ccccc4NC3N1C(=O)C(N)Cc2ccccc2
Molecular formulaC40H52N6O8
Chemical information
Species origin
Functionality
Literature