Quorumpeps Molecule

Quorumpeps®

Ac-SPNIFGQWM, lacton linkage between S1 and M9

Quorumpeps moleculeID9
SMILESO=C1OCC(C(=O)N5C(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)NCC(=O)NC(C(=O)NC(C(=O)NC1CCSC)Cc3c2ccccc2nc3)CCC(=O)N)Cc4ccccc4)C(C)CC)CC(=O)N)CCC5)NC(=O)C
Molecular formulaC52H70N12O13S
Chemical information
Species origin
Functionality
Literature