Quorumpeps Molecule

Quorumpeps®

AIFW(Geranyl)EQ

Quorumpeps moleculeID90
SMILESO=C(O)C(CCC(N)=O)NC(=O)C(CCC(=O)O)NC(=O)C1CC3(C\C=C(/C)CC\C=C(/C)C)c4ccccc4NC3N1C(=O)C(Cc2ccccc2)NC(=O)C(NC(=O)C(C)N)C(C)CC
Molecular formulaC49H68N8O10
Chemical information
Species origin
Functionality
Literature