Quorumpeps Molecule

Quorumpeps®

FHWWQTSPAHFS

Quorumpeps moleculeID92
SMILESO=C(NC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)O)CO)Cc1ccccc1)Cc2cncn2)C)C9N(C(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)Cc3ccccc3)Cc4cncn4)Cc6c5ccccc5nc6)Cc8c7ccccc7nc8)CCC(=O)N)C(O)C)CO)CCC9
Molecular formulaC75H91N19O17
Chemical information
Species origin
Functionality
Literature