Quorumpeps Molecule

Quorumpeps®

FLVMFLSG

Quorumpeps moleculeID93
SMILESO=C(O)CNC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)C(N)Cc1ccccc1)CC(C)C)C(C)C)CCSC)Cc2ccccc2)CC(C)C)CO
Molecular formulaC45H68N8O10S
Chemical information
Species origin
Functionality
Literature